C19H21F3N4O2 — CID 123850226
3-methyl-2-[2-(methylideneamino)-1-[[2-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]-3-pyridinyl]methoxy]ethenyl]but-2-en-1-ol (PubChem CID 123850226) has the molecular formula C19H21F3N4O2 and a molecular weight of 394.40 g/mol. Its IUPAC name is 3-methyl-2-[2-(methylideneamino)-1-[[2-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]-3-pyridinyl]methoxy]ethenyl]but-2-en-1-ol.
| Compound Name | 3-methyl-2-[2-(methylideneamino)-1-[[2-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]-3-pyridinyl]methoxy]ethenyl]but-2-en-1-ol |
|---|---|
| PubChem CID | 123850226 |
| Molecular Formula | C19H21F3N4O2 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 3-methyl-2-[2-(methylideneamino)-1-[[2-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]-3-pyridinyl]methoxy]ethenyl]but-2-en-1-ol |
| SMILES | C=NC=C(OCc1cccnc1-c1ccnn1CC(F)(F)F)C(CO)=C(C)C |
| InChI | InChI=1S/C19H21F3N4O2/c1-13(2)15(10-27)17(9-23-3)28-11-14-5-4-7-24-18(14)16-6-8-25-26(16)12-19(20,21)22/h4-9,27H,3,10-12H2,1-2H3 |
| InChIKey | MUDGJCDYKOTSFR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|