About 2-(oxolan-2-yl)ethyl 2-cyano-2-[3-(3-methoxypropylimino)cyclohexen-1-yl]acetate
2-(oxolan-2-yl)ethyl 2-cyano-2-[3-(3-methoxypropylimino)cyclohexen-1-yl]acetate (PubChem CID 123850635) has the molecular formula C19H28N2O4
and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-(oxolan-2-yl)ethyl 2-cyano-2-[3-(3-methoxypropylimino)cyclohexen-1-yl]acetate.
Molecular Properties
| Compound Name | 2-(oxolan-2-yl)ethyl 2-cyano-2-[3-(3-methoxypropylimino)cyclohexen-1-yl]acetate |
| PubChem CID | 123850635 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-(oxolan-2-yl)ethyl 2-cyano-2-[3-(3-methoxypropylimino)cyclohexen-1-yl]acetate |
| SMILES | COCCC/N=C1/C=C(C(C#N)C(=O)OCCC2CCCO2)CCC1 |
| InChI | InChI=1S/C19H28N2O4/c1-23-10-4-9-21-16-6-2-5-15(13-16)18(14-20)19(22)25-12-8-17-7-3-11-24-17/h13,17-18H,2-12H2,1H3/b21-16+ |
| InChIKey | JCYWWWCZJKEEOA-LTGZKZEYSA-N |
| XLogP | 2.83 |
| TPSA | 80.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxolan-2-yl)ethyl 2-cyano-2-[3-(3-methoxypropylimino)cyclohexen-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxolan-2-yl)ethyl 2-cyano-2-[3-(3-methoxypropylimino)cyclohexen-1-yl]acetate?
The IUPAC name of 2-(oxolan-2-yl)ethyl 2-cyano-2-[3-(3-methoxypropylimino)cyclohexen-1-yl]acetate (CID 123850635) is 2-(oxolan-2-yl)ethyl 2-cyano-2-[3-(3-methoxypropylimino)cyclohexen-1-yl]acetate.
What is the SMILES notation for 2-(oxolan-2-yl)ethyl 2-cyano-2-[3-(3-methoxypropylimino)cyclohexen-1-yl]acetate?
The canonical SMILES for 2-(oxolan-2-yl)ethyl 2-cyano-2-[3-(3-methoxypropylimino)cyclohexen-1-yl]acetate is COCCC/N=C1/C=C(C(C#N)C(=O)OCCC2CCCO2)CCC1.
What is the InChIKey of 2-(oxolan-2-yl)ethyl 2-cyano-2-[3-(3-methoxypropylimino)cyclohexen-1-yl]acetate?
The InChIKey is JCYWWWCZJKEEOA-LTGZKZEYSA-N. The full InChI is InChI=1S/C19H28N2O4/c1-23-10-4-9-21-16-6-2-5-15(13-16)18(14-20)19(22)25-12-8-17-7-3-11-24-17/h13,17-18H,2-12H2,1H3/b21-16+.
What are the key properties of 2-(oxolan-2-yl)ethyl 2-cyano-2-[3-(3-methoxypropylimino)cyclohexen-1-yl]acetate?
2-(oxolan-2-yl)ethyl 2-cyano-2-[3-(3-methoxypropylimino)cyclohexen-1-yl]acetate has a molecular weight of 348.44 g/mol, XLogP of 2.83, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxolan-2-yl)ethyl 2-cyano-2-[3-(3-methoxypropylimino)cyclohexen-1-yl]acetate is sourced from PubChem (CID 123850635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).