C15H27NS — CID 123851210
3,3-dimethylbut-1-en-2-yl N-(3,3-dimethylbut-1-en-2-yl)propanimidothioate (PubChem CID 123851210) has the molecular formula C15H27NS and a molecular weight of 253.45 g/mol. Its IUPAC name is 3,3-dimethylbut-1-en-2-yl N-(3,3-dimethylbut-1-en-2-yl)propanimidothioate.
| Compound Name | 3,3-dimethylbut-1-en-2-yl N-(3,3-dimethylbut-1-en-2-yl)propanimidothioate |
|---|---|
| PubChem CID | 123851210 |
| Molecular Formula | C15H27NS |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 3,3-dimethylbut-1-en-2-yl N-(3,3-dimethylbut-1-en-2-yl)propanimidothioate |
| SMILES | C=C(/N=C(\CC)SC(=C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H27NS/c1-10-13(16-11(2)14(4,5)6)17-12(3)15(7,8)9/h2-3,10H2,1,4-9H3/b16-13+ |
| InChIKey | VWDGIRPNKLRLNN-DTQAZKPQSA-N |
| XLogP | 5.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|