C19H36S — CID 89308198
(Z)-3-(3,3-dimethylbut-1-en-2-ylsulfanyl)-2,2-dimethylundec-3-ene (PubChem CID 89308198) has the molecular formula C19H36S and a molecular weight of 296.56 g/mol. Its IUPAC name is (Z)-3-(3,3-dimethylbut-1-en-2-ylsulfanyl)-2,2-dimethylundec-3-ene.
| Compound Name | (Z)-3-(3,3-dimethylbut-1-en-2-ylsulfanyl)-2,2-dimethylundec-3-ene |
|---|---|
| PubChem CID | 89308198 |
| Molecular Formula | C19H36S |
| Molecular Weight | 296.56 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | (Z)-3-(3,3-dimethylbut-1-en-2-ylsulfanyl)-2,2-dimethylundec-3-ene |
| SMILES | C=C(S/C(=C\CCCCCCC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H36S/c1-9-10-11-12-13-14-15-17(19(6,7)8)20-16(2)18(3,4)5/h15H,2,9-14H2,1,3-8H3/b17-15- |
| InChIKey | HEKYSDMVISNPIY-ICFOKQHNSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.56 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|