C42H73NO3 — CID 123851406
4-[(3S,10S,13R,17R)-10,13-dimethyl-3-(octadec-9-enoylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 123851406) has the molecular formula C42H73NO3 and a molecular weight of 640.05 g/mol. Its IUPAC name is 4-[(3S,10S,13R,17R)-10,13-dimethyl-3-(octadec-9-enoylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | 4-[(3S,10S,13R,17R)-10,13-dimethyl-3-(octadec-9-enoylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 123851406 |
| Molecular Formula | C42H73NO3 |
| Molecular Weight | 640.05 g/mol |
| Exact Mass | 639.56 |
| IUPAC Name | 4-[(3S,10S,13R,17R)-10,13-dimethyl-3-(octadec-9-enoylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N[C@H]1CC[C@@]2(C)C(CCC3C2CC[C@@]2(C)C3CC[C@@H]2C(C)CCC(=O)O)C1 |
| InChI | InChI=1S/C42H73NO3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-39(44)43-34-27-29-41(3)33(31-34)22-23-35-37-25-24-36(32(2)21-26-40(45)46)42(37,4)30-28-38(35)41/h12-13,32-38H,5-11,14-31H2,1-4H3,(H,43,44)(H,45,46)/t32?,33?,34-,35?,36+,37?,38?,41-,42+/m0/s1 |
| InChIKey | VIPHDFJJYZNYES-PGRRVASVSA-N |
| XLogP | 11.67 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.05 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|