C42H72INO2 — CID 143815748
(4R)-4-[10,13-dimethyl-3-[[(Z)-octadec-9-enoyl]amino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl iodide (PubChem CID 143815748) has the molecular formula C42H72INO2 and a molecular weight of 749.95 g/mol. Its IUPAC name is (4R)-4-[10,13-dimethyl-3-[[(Z)-octadec-9-enoyl]amino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl iodide.
| Compound Name | (4R)-4-[10,13-dimethyl-3-[[(Z)-octadec-9-enoyl]amino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl iodide |
|---|---|
| PubChem CID | 143815748 |
| Molecular Formula | C42H72INO2 |
| Molecular Weight | 749.95 g/mol |
| Exact Mass | 749.46 |
| IUPAC Name | (4R)-4-[10,13-dimethyl-3-[[(Z)-octadec-9-enoyl]amino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl iodide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NC1CCC2(C)C(CCC3C2CCC2(C)C3CCC2[C@H](C)CCC(=O)I)C1 |
| InChI | InChI=1S/C42H72INO2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-40(46)44-34-27-29-41(3)33(31-34)22-23-35-37-25-24-36(32(2)21-26-39(43)45)42(37,4)30-28-38(35)41/h12-13,32-38H,5-11,14-31H2,1-4H3,(H,44,46)/b13-12-/t32-,33?,34?,35?,36?,37?,38?,41?,42?/m1/s1 |
| InChIKey | PQXDKIJGWAIRIP-ISSXNIJLSA-N |
| XLogP | 12.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.95 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|