C45H79NO2 — CID 138722763
(Z)-N-[(3S,10S,13R)-10,13-dimethyl-17-[(2R)-6-methyl-5-oxoheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]octadec-9-enamide (PubChem CID 138722763) has the molecular formula C45H79NO2 and a molecular weight of 666.13 g/mol. Its IUPAC name is (Z)-N-[(3S,10S,13R)-10,13-dimethyl-17-[(2R)-6-methyl-5-oxoheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]octadec-9-enamide.
| Compound Name | (Z)-N-[(3S,10S,13R)-10,13-dimethyl-17-[(2R)-6-methyl-5-oxoheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]octadec-9-enamide |
|---|---|
| PubChem CID | 138722763 |
| Molecular Formula | C45H79NO2 |
| Molecular Weight | 666.13 g/mol |
| Exact Mass | 665.61 |
| IUPAC Name | (Z)-N-[(3S,10S,13R)-10,13-dimethyl-17-[(2R)-6-methyl-5-oxoheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@H]1CC[C@@]2(C)C(CCC3C2CC[C@@]2(C)C3CCC2[C@H](C)CCC(=O)C(C)C)C1 |
| InChI | InChI=1S/C45H79NO2/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-43(48)46-37-29-31-44(5)36(33-37)24-25-38-40-27-26-39(45(40,6)32-30-41(38)44)35(4)23-28-42(47)34(2)3/h14-15,34-41H,7-13,16-33H2,1-6H3,(H,46,48)/b15-14-/t35-,36?,37+,38?,39?,40?,41?,44+,45-/m1/s1 |
| InChIKey | ZGKUXJXFRQYMIZ-BSDSKRHKSA-N |
| XLogP | 12.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.13 |
| LogP ≤ 5 | 12.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|