C42H70O3 — CID 91201395
(4R)-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-octadec-9-enoyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 91201395) has the molecular formula C42H70O3 and a molecular weight of 623.02 g/mol. Its IUPAC name is (4R)-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-octadec-9-enoyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-octadec-9-enoyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 91201395 |
| Molecular Formula | C42H70O3 |
| Molecular Weight | 623.02 g/mol |
| Exact Mass | 622.53 |
| IUPAC Name | (4R)-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-octadec-9-enoyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C1=CC[C@@]2(C)C(CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCC(=O)O)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C42H70O3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-39(43)33-27-29-41(3)34(31-33)22-23-35-37-25-24-36(32(2)21-26-40(44)45)42(37,4)30-28-38(35)41/h12-13,27,32,34-38H,5-11,14-26,28-31H2,1-4H3,(H,44,45)/t32-,34?,35+,36-,37+,38+,41+,42-/m1/s1 |
| InChIKey | BHAZLNXZTQXTAH-HSKAAQHGSA-N |
| XLogP | 12.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.02 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|