C21H22FN5O2S — CID 123852470
1-[[1-[2-(3,5-dimethylanilino)-5-fluoropyrimidin-4-yl]pyrrol-3-yl]methyl]-2,3-dihydropyrrole-4-sulfinic acid (PubChem CID 123852470) has the molecular formula C21H22FN5O2S and a molecular weight of 427.51 g/mol. Its IUPAC name is 1-[[1-[2-(3,5-dimethylanilino)-5-fluoropyrimidin-4-yl]pyrrol-3-yl]methyl]-2,3-dihydropyrrole-4-sulfinic acid.
| Compound Name | 1-[[1-[2-(3,5-dimethylanilino)-5-fluoropyrimidin-4-yl]pyrrol-3-yl]methyl]-2,3-dihydropyrrole-4-sulfinic acid |
|---|---|
| PubChem CID | 123852470 |
| Molecular Formula | C21H22FN5O2S |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-[[1-[2-(3,5-dimethylanilino)-5-fluoropyrimidin-4-yl]pyrrol-3-yl]methyl]-2,3-dihydropyrrole-4-sulfinic acid |
| SMILES | Cc1cc(C)cc(Nc2ncc(F)c(-n3ccc(CN4C=C(S(=O)O)CC4)c3)n2)c1 |
| InChI | InChI=1S/C21H22FN5O2S/c1-14-7-15(2)9-17(8-14)24-21-23-10-19(22)20(25-21)27-6-3-16(12-27)11-26-5-4-18(13-26)30(28)29/h3,6-10,12-13H,4-5,11H2,1-2H3,(H,28,29)(H,23,24,25) |
| InChIKey | JFMIWMKUBPCUHD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|