C20H42N2Si2 — CID 123853994
1-N,3-N-di(butan-2-yl)-1-N,3-N-dicyclopentyl-1,3-disiletane-1,3-diamine (PubChem CID 123853994) has the molecular formula C20H42N2Si2 and a molecular weight of 366.74 g/mol. Its IUPAC name is 1-N,3-N-di(butan-2-yl)-1-N,3-N-dicyclopentyl-1,3-disiletane-1,3-diamine.
| Compound Name | 1-N,3-N-di(butan-2-yl)-1-N,3-N-dicyclopentyl-1,3-disiletane-1,3-diamine |
|---|---|
| PubChem CID | 123853994 |
| Molecular Formula | C20H42N2Si2 |
| Molecular Weight | 366.74 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | 1-N,3-N-di(butan-2-yl)-1-N,3-N-dicyclopentyl-1,3-disiletane-1,3-diamine |
| SMILES | CCC(C)N(C1CCCC1)[SiH]1C[SiH](N(C(C)CC)C2CCCC2)C1 |
| InChI | InChI=1S/C20H42N2Si2/c1-5-17(3)21(19-11-7-8-12-19)23-15-24(16-23)22(18(4)6-2)20-13-9-10-14-20/h17-20,23-24H,5-16H2,1-4H3 |
| InChIKey | GMPUSJGBGHJKTJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.74 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|