C21H29NO6 — CID 123854280
3-hydroxy-4,8,8,12-tetramethoxy-17-methyl-17-azatricyclo[7.5.3.02,7]heptadeca-2(7),3,5,11-tetraen-13-one (PubChem CID 123854280) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is 3-hydroxy-4,8,8,12-tetramethoxy-17-methyl-17-azatricyclo[7.5.3.02,7]heptadeca-2(7),3,5,11-tetraen-13-one.
| Compound Name | 3-hydroxy-4,8,8,12-tetramethoxy-17-methyl-17-azatricyclo[7.5.3.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
|---|---|
| PubChem CID | 123854280 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 3-hydroxy-4,8,8,12-tetramethoxy-17-methyl-17-azatricyclo[7.5.3.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
| SMILES | COC1=CCC2N(C)CCC(CC1=O)c1c(ccc(OC)c1O)C2(OC)OC |
| InChI | InChI=1S/C21H29NO6/c1-22-11-10-13-12-15(23)16(25-2)8-9-18(22)21(27-4,28-5)14-6-7-17(26-3)20(24)19(13)14/h6-8,13,18,24H,9-12H2,1-5H3 |
| InChIKey | WYFSAUWCDWEAHU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|