C15H18F3N3O — CID 123854945
3,4,7,7-tetramethyl-4-(trifluoromethyl)-2,4a,6,8-tetrahydropyrazolo[3,4-b]quinolin-5-one (PubChem CID 123854945) has the molecular formula C15H18F3N3O and a molecular weight of 313.32 g/mol. Its IUPAC name is 3,4,7,7-tetramethyl-4-(trifluoromethyl)-2,4a,6,8-tetrahydropyrazolo[3,4-b]quinolin-5-one.
| Compound Name | 3,4,7,7-tetramethyl-4-(trifluoromethyl)-2,4a,6,8-tetrahydropyrazolo[3,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 123854945 |
| Molecular Formula | C15H18F3N3O |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 3,4,7,7-tetramethyl-4-(trifluoromethyl)-2,4a,6,8-tetrahydropyrazolo[3,4-b]quinolin-5-one |
| SMILES | Cc1[nH]nc2c1C(C)(C(F)(F)F)C1C(=O)CC(C)(C)CC1=N2 |
| InChI | InChI=1S/C15H18F3N3O/c1-7-10-12(21-20-7)19-8-5-13(2,3)6-9(22)11(8)14(10,4)15(16,17)18/h11H,5-6H2,1-4H3,(H,20,21) |
| InChIKey | VDHDFEDWVLALPS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |