C20H16F7N3O — CID 123876024
4-[4-fluoro-2-(trifluoromethyl)phenyl]-7,7-dimethyl-3-(trifluoromethyl)-4,4a,6,8-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one (PubChem CID 123876024) has the molecular formula C20H16F7N3O and a molecular weight of 447.35 g/mol. Its IUPAC name is 4-[4-fluoro-2-(trifluoromethyl)phenyl]-7,7-dimethyl-3-(trifluoromethyl)-4,4a,6,8-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one.
| Compound Name | 4-[4-fluoro-2-(trifluoromethyl)phenyl]-7,7-dimethyl-3-(trifluoromethyl)-4,4a,6,8-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 123876024 |
| Molecular Formula | C20H16F7N3O |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 4-[4-fluoro-2-(trifluoromethyl)phenyl]-7,7-dimethyl-3-(trifluoromethyl)-4,4a,6,8-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one |
| SMILES | CC1(C)CC(=O)C2C(=Nc3n[nH]c(C(F)(F)F)c3C2c2ccc(F)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C20H16F7N3O/c1-18(2)6-11-14(12(31)7-18)13(9-4-3-8(21)5-10(9)19(22,23)24)15-16(20(25,26)27)29-30-17(15)28-11/h3-5,13-14H,6-7H2,1-2H3,(H,29,30) |
| InChIKey | YROBSLHNUWROQH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |