C24H20F3N3O4 — CID 134715932
(5S)-8,8-dimethyl-5-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-5,5a,7,9-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 134715932) has the molecular formula C24H20F3N3O4 and a molecular weight of 471.44 g/mol. Its IUPAC name is (5S)-8,8-dimethyl-5-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-5,5a,7,9-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | (5S)-8,8-dimethyl-5-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-5,5a,7,9-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 134715932 |
| Molecular Formula | C24H20F3N3O4 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | (5S)-8,8-dimethyl-5-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-5,5a,7,9-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | CC1(C)CC(=O)C2C(=Nc3[nH]c(=O)[nH]c(=O)c3[C@H]2c2ccc(-c3cccc(C(F)(F)F)c3)o2)C1 |
| InChI | InChI=1S/C24H20F3N3O4/c1-23(2)9-13-17(14(31)10-23)18(19-20(28-13)29-22(33)30-21(19)32)16-7-6-15(34-16)11-4-3-5-12(8-11)24(25,26)27/h3-8,17-18H,9-10H2,1-2H3,(H2,29,30,32,33)/t17?,18-/m0/s1 |
| InChIKey | FDYRPMDYOIWFCJ-ZVAWYAOSSA-N |
| XLogP | 4.57 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |