C23H21N3O4 — CID 18809335
8,8-dimethyl-5-(5-phenylfuran-2-yl)-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 18809335) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 8,8-dimethyl-5-(5-phenylfuran-2-yl)-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | 8,8-dimethyl-5-(5-phenylfuran-2-yl)-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 18809335 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 8,8-dimethyl-5-(5-phenylfuran-2-yl)-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1[nH]c(=O)[nH]c(=O)c1C2c1ccc(-c2ccccc2)o1 |
| InChI | InChI=1S/C23H21N3O4/c1-23(2)10-13-17(14(27)11-23)18(19-20(24-13)25-22(29)26-21(19)28)16-9-8-15(30-16)12-6-4-3-5-7-12/h3-9,18H,10-11H2,1-2H3,(H3,24,25,26,28,29) |
| InChIKey | AYCZXURNLIFGJU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 107.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |