C23H19Cl2N3O3S — CID 3672288
5-[5-(3,4-dichlorophenyl)furan-2-yl]-8,8-dimethyl-2-sulfanylidene-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 3672288) has the molecular formula C23H19Cl2N3O3S and a molecular weight of 488.40 g/mol. Its IUPAC name is 5-[5-(3,4-dichlorophenyl)furan-2-yl]-8,8-dimethyl-2-sulfanylidene-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 5-[5-(3,4-dichlorophenyl)furan-2-yl]-8,8-dimethyl-2-sulfanylidene-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 3672288 |
| Molecular Formula | C23H19Cl2N3O3S |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | 5-[5-(3,4-dichlorophenyl)furan-2-yl]-8,8-dimethyl-2-sulfanylidene-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1[nH]c(=S)[nH]c(=O)c1C2c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C23H19Cl2N3O3S/c1-23(2)8-13-17(14(29)9-23)18(19-20(26-13)27-22(32)28-21(19)30)16-6-5-15(31-16)10-3-4-11(24)12(25)7-10/h3-7,18H,8-9H2,1-2H3,(H3,26,27,28,30,32) |
| InChIKey | PXBWGGNOCHCWAJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|