C28H31NO3 — CID 4135275
3,3,6,6-tetramethyl-9-[5-(4-methylphenyl)furan-2-yl]-2,4,5,7,9,10-hexahydroacridine-1,8-dione (PubChem CID 4135275) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-9-[5-(4-methylphenyl)furan-2-yl]-2,4,5,7,9,10-hexahydroacridine-1,8-dione.
| Compound Name | 3,3,6,6-tetramethyl-9-[5-(4-methylphenyl)furan-2-yl]-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 4135275 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 3,3,6,6-tetramethyl-9-[5-(4-methylphenyl)furan-2-yl]-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
| SMILES | Cc1ccc(-c2ccc(C3C4=C(CC(C)(C)CC4=O)NC4=C3C(=O)CC(C)(C)C4)o2)cc1 |
| InChI | InChI=1S/C28H31NO3/c1-16-6-8-17(9-7-16)22-10-11-23(32-22)26-24-18(12-27(2,3)14-20(24)30)29-19-13-28(4,5)15-21(31)25(19)26/h6-11,26,29H,12-15H2,1-5H3 |
| InChIKey | DXESXQRWYVRBGH-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |