C21H17N3O4 — CID 7273119
(5R)-5-(5-phenylfuran-2-yl)-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 7273119) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is (5R)-5-(5-phenylfuran-2-yl)-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | (5R)-5-(5-phenylfuran-2-yl)-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 7273119 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | (5R)-5-(5-phenylfuran-2-yl)-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | O=C1CCCC2=C1[C@@H](c1ccc(-c3ccccc3)o1)c1c([nH]c(=O)[nH]c1=O)N2 |
| InChI | InChI=1S/C21H17N3O4/c25-13-8-4-7-12-16(13)17(18-19(22-12)23-21(27)24-20(18)26)15-10-9-14(28-15)11-5-2-1-3-6-11/h1-3,5-6,9-10,17H,4,7-8H2,(H3,22,23,24,26,27)/t17-/m1/s1 |
| InChIKey | DHKJEKYJIACYIK-QGZVFWFLSA-N |
| XLogP | 2.89 |
| TPSA | 107.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |