C17H13Cl2N3O3 — CID 27881055
(5R)-5-(2,3-dichlorophenyl)-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 27881055) has the molecular formula C17H13Cl2N3O3 and a molecular weight of 378.22 g/mol. Its IUPAC name is (5R)-5-(2,3-dichlorophenyl)-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | (5R)-5-(2,3-dichlorophenyl)-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 27881055 |
| Molecular Formula | C17H13Cl2N3O3 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | (5R)-5-(2,3-dichlorophenyl)-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | O=C1CCCC2=C1[C@@H](c1cccc(Cl)c1Cl)c1c([nH]c(=O)[nH]c1=O)N2 |
| InChI | InChI=1S/C17H13Cl2N3O3/c18-8-4-1-3-7(14(8)19)11-12-9(5-2-6-10(12)23)20-15-13(11)16(24)22-17(25)21-15/h1,3-4,11H,2,5-6H2,(H3,20,21,22,24,25)/t11-/m1/s1 |
| InChIKey | UWBMZTGBZNUIAN-LLVKDONJSA-N |
| XLogP | 2.93 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |