C25H20F3NO2 — CID 6964986
(10S)-7,7-dimethyl-10-[2-(trifluoromethyl)phenyl]-6,8,9a,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione (PubChem CID 6964986) has the molecular formula C25H20F3NO2 and a molecular weight of 423.43 g/mol. Its IUPAC name is (10S)-7,7-dimethyl-10-[2-(trifluoromethyl)phenyl]-6,8,9a,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione.
| Compound Name | (10S)-7,7-dimethyl-10-[2-(trifluoromethyl)phenyl]-6,8,9a,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
|---|---|
| PubChem CID | 6964986 |
| Molecular Formula | C25H20F3NO2 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (10S)-7,7-dimethyl-10-[2-(trifluoromethyl)phenyl]-6,8,9a,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
| SMILES | CC1(C)CC(=O)C2C(=NC3=C(C(=O)c4ccccc43)[C@@H]2c2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C25H20F3NO2/c1-24(2)11-17-20(18(30)12-24)19(15-9-5-6-10-16(15)25(26,27)28)21-22(29-17)13-7-3-4-8-14(13)23(21)31/h3-10,19-20H,11-12H2,1-2H3/t19-,20?/m1/s1 |
| InChIKey | XWWXWFATCGCUMV-FIWHBWSRSA-N |
| XLogP | 5.86 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |