C24H21NO3 — CID 6969516
(10S)-10-(4-hydroxyphenyl)-7,7-dimethyl-6,8,9a,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione (PubChem CID 6969516) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is (10S)-10-(4-hydroxyphenyl)-7,7-dimethyl-6,8,9a,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione.
| Compound Name | (10S)-10-(4-hydroxyphenyl)-7,7-dimethyl-6,8,9a,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
|---|---|
| PubChem CID | 6969516 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (10S)-10-(4-hydroxyphenyl)-7,7-dimethyl-6,8,9a,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
| SMILES | CC1(C)CC(=O)C2C(=NC3=C(C(=O)c4ccccc43)[C@@H]2c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C24H21NO3/c1-24(2)11-17-20(18(27)12-24)19(13-7-9-14(26)10-8-13)21-22(25-17)15-5-3-4-6-16(15)23(21)28/h3-10,19-20,26H,11-12H2,1-2H3/t19-,20?/m1/s1 |
| InChIKey | HRZCOQUVMHZPOL-FIWHBWSRSA-N |
| XLogP | 4.54 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |