C24H20FNO2 — CID 7188711
(10R)-10-(3-fluorophenyl)-7,7-dimethyl-6,8,9a,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione (PubChem CID 7188711) has the molecular formula C24H20FNO2 and a molecular weight of 373.43 g/mol. Its IUPAC name is (10R)-10-(3-fluorophenyl)-7,7-dimethyl-6,8,9a,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione.
| Compound Name | (10R)-10-(3-fluorophenyl)-7,7-dimethyl-6,8,9a,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
|---|---|
| PubChem CID | 7188711 |
| Molecular Formula | C24H20FNO2 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (10R)-10-(3-fluorophenyl)-7,7-dimethyl-6,8,9a,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
| SMILES | CC1(C)CC(=O)C2C(=NC3=C(C(=O)c4ccccc43)[C@H]2c2cccc(F)c2)C1 |
| InChI | InChI=1S/C24H20FNO2/c1-24(2)11-17-20(18(27)12-24)19(13-6-5-7-14(25)10-13)21-22(26-17)15-8-3-4-9-16(15)23(21)28/h3-10,19-20H,11-12H2,1-2H3/t19-,20?/m0/s1 |
| InChIKey | GDZFZTGWXWKLBH-XJDOXCRVSA-N |
| XLogP | 4.98 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |