C26H29N3O2 — CID 54431458
9-(3-imidazol-1-ylphenyl)-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione (PubChem CID 54431458) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 9-(3-imidazol-1-ylphenyl)-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione.
| Compound Name | 9-(3-imidazol-1-ylphenyl)-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 54431458 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 9-(3-imidazol-1-ylphenyl)-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2C(=NC3=C(C(=O)CC(C)(C)C3)C2c2cccc(-n3ccnc3)c2)C1 |
| InChI | InChI=1S/C26H29N3O2/c1-25(2)11-18-23(20(30)13-25)22(24-19(28-18)12-26(3,4)14-21(24)31)16-6-5-7-17(10-16)29-9-8-27-15-29/h5-10,15,22-23H,11-14H2,1-4H3 |
| InChIKey | WHTPJUAVOWDMSK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |