C23H25Cl2NO3 — CID 11860928
(8aR,9S)-9-(3,5-dichloro-4-hydroxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione (PubChem CID 11860928) has the molecular formula C23H25Cl2NO3 and a molecular weight of 434.36 g/mol. Its IUPAC name is (8aR,9S)-9-(3,5-dichloro-4-hydroxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione.
| Compound Name | (8aR,9S)-9-(3,5-dichloro-4-hydroxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 11860928 |
| Molecular Formula | C23H25Cl2NO3 |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | (8aR,9S)-9-(3,5-dichloro-4-hydroxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione |
| SMILES | CC1(C)CC(=O)[C@H]2C(=NC3=C(C(=O)CC(C)(C)C3)[C@@H]2c2cc(Cl)c(O)c(Cl)c2)C1 |
| InChI | InChI=1S/C23H25Cl2NO3/c1-22(2)7-14-19(16(27)9-22)18(11-5-12(24)21(29)13(25)6-11)20-15(26-14)8-23(3,4)10-17(20)28/h5-6,18-19,29H,7-10H2,1-4H3/t18-,19-/m1/s1 |
| InChIKey | WHTZXGZQGPGFQQ-RTBURBONSA-N |
| XLogP | 5.89 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |