C23H25N2O5- — CID 7401068
2-nitro-4-[(9R)-3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,8a,9-hexahydroacridin-9-yl]phenolate (PubChem CID 7401068) has the molecular formula C23H25N2O5- and a molecular weight of 409.46 g/mol. Its IUPAC name is 2-nitro-4-[(9R)-3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,8a,9-hexahydroacridin-9-yl]phenolate.
| Compound Name | 2-nitro-4-[(9R)-3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,8a,9-hexahydroacridin-9-yl]phenolate |
|---|---|
| PubChem CID | 7401068 |
| Molecular Formula | C23H25N2O5- |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-nitro-4-[(9R)-3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,8a,9-hexahydroacridin-9-yl]phenolate |
| SMILES | CC1(C)CC(=O)C2C(=NC3=C(C(=O)CC(C)(C)C3)[C@H]2c2ccc([O-])c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C23H26N2O5/c1-22(2)8-13-20(17(27)10-22)19(12-5-6-16(26)15(7-12)25(29)30)21-14(24-13)9-23(3,4)11-18(21)28/h5-7,19-20,26H,8-11H2,1-4H3/p-1/t19-,20?/m0/s1 |
| InChIKey | GVSMCFCRMKKOQR-XJDOXCRVSA-M |
| XLogP | 3.86 |
| TPSA | 112.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|