C32H35ClFNO4 — CID 9497778
(9S)-9-[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione (PubChem CID 9497778) has the molecular formula C32H35ClFNO4 and a molecular weight of 552.09 g/mol. Its IUPAC name is (9S)-9-[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione.
| Compound Name | (9S)-9-[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 9497778 |
| Molecular Formula | C32H35ClFNO4 |
| Molecular Weight | 552.09 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | (9S)-9-[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione |
| SMILES | CCOc1cc([C@H]2C3=C(CC(C)(C)CC3=O)N=C3CC(C)(C)CC(=O)C32)cc(Cl)c1OCc1ccccc1F |
| InChI | InChI=1S/C32H35ClFNO4/c1-6-38-26-12-19(11-20(33)30(26)39-17-18-9-7-8-10-21(18)34)27-28-22(13-31(2,3)15-24(28)36)35-23-14-32(4,5)16-25(37)29(23)27/h7-12,27-28H,6,13-17H2,1-5H3/t27-,28?/m1/s1 |
| InChIKey | DVDXJGFBWRUVJR-QXPUDEPPSA-N |
| XLogP | 7.64 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.09 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |