C24H29NO2 — CID 7014014
(9R)-3,3,6,6-tetramethyl-9-(4-methylphenyl)-2,4,5,7,8a,9-hexahydroacridine-1,8-dione (PubChem CID 7014014) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is (9R)-3,3,6,6-tetramethyl-9-(4-methylphenyl)-2,4,5,7,8a,9-hexahydroacridine-1,8-dione.
| Compound Name | (9R)-3,3,6,6-tetramethyl-9-(4-methylphenyl)-2,4,5,7,8a,9-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 7014014 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (9R)-3,3,6,6-tetramethyl-9-(4-methylphenyl)-2,4,5,7,8a,9-hexahydroacridine-1,8-dione |
| SMILES | Cc1ccc([C@@H]2C3=C(CC(C)(C)CC3=O)N=C3CC(C)(C)CC(=O)C32)cc1 |
| InChI | InChI=1S/C24H29NO2/c1-14-6-8-15(9-7-14)20-21-16(10-23(2,3)12-18(21)26)25-17-11-24(4,5)13-19(27)22(17)20/h6-9,20-21H,10-13H2,1-5H3/t20-,21?/m0/s1 |
| InChIKey | QLYXJISRJKKPDE-BGERDNNASA-N |
| XLogP | 5.18 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |