C25H31NO4 — CID 7313199
(9R)-9-(2,3-dimethoxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione (PubChem CID 7313199) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is (9R)-9-(2,3-dimethoxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione.
| Compound Name | (9R)-9-(2,3-dimethoxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 7313199 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (9R)-9-(2,3-dimethoxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione |
| SMILES | COc1cccc([C@@H]2C3=C(CC(C)(C)CC3=O)N=C3CC(C)(C)CC(=O)C32)c1OC |
| InChI | InChI=1S/C25H31NO4/c1-24(2)10-15-21(17(27)12-24)20(14-8-7-9-19(29-5)23(14)30-6)22-16(26-15)11-25(3,4)13-18(22)28/h7-9,20-21H,10-13H2,1-6H3/t20-,21?/m0/s1 |
| InChIKey | SFIAUUWSBHHXOG-BGERDNNASA-N |
| XLogP | 4.89 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |