C22H27NO6 — CID 91248248
2,7,7-trimethyl-5-oxo-4-(2,3,4-trimethoxyphenyl)-4,4a,6,8-tetrahydroquinoline-3-carboxylic acid (PubChem CID 91248248) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2,7,7-trimethyl-5-oxo-4-(2,3,4-trimethoxyphenyl)-4,4a,6,8-tetrahydroquinoline-3-carboxylic acid.
| Compound Name | 2,7,7-trimethyl-5-oxo-4-(2,3,4-trimethoxyphenyl)-4,4a,6,8-tetrahydroquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 91248248 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2,7,7-trimethyl-5-oxo-4-(2,3,4-trimethoxyphenyl)-4,4a,6,8-tetrahydroquinoline-3-carboxylic acid |
| SMILES | COc1ccc(C2C(C(=O)O)=C(C)N=C3CC(C)(C)CC(=O)C32)c(OC)c1OC |
| InChI | InChI=1S/C22H27NO6/c1-11-16(21(25)26)17(18-13(23-11)9-22(2,3)10-14(18)24)12-7-8-15(27-4)20(29-6)19(12)28-5/h7-8,17-18H,9-10H2,1-6H3,(H,25,26) |
| InChIKey | SCNGOFANXPAONE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |