C24H19N2O5- — CID 6968010
2-[(10R)-7,7-dimethyl-9,11-dioxo-6,8,9a,10-tetrahydroindeno[1,2-b]quinolin-10-yl]-4-nitrophenolate (PubChem CID 6968010) has the molecular formula C24H19N2O5- and a molecular weight of 415.43 g/mol. Its IUPAC name is 2-[(10R)-7,7-dimethyl-9,11-dioxo-6,8,9a,10-tetrahydroindeno[1,2-b]quinolin-10-yl]-4-nitrophenolate.
| Compound Name | 2-[(10R)-7,7-dimethyl-9,11-dioxo-6,8,9a,10-tetrahydroindeno[1,2-b]quinolin-10-yl]-4-nitrophenolate |
|---|---|
| PubChem CID | 6968010 |
| Molecular Formula | C24H19N2O5- |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-[(10R)-7,7-dimethyl-9,11-dioxo-6,8,9a,10-tetrahydroindeno[1,2-b]quinolin-10-yl]-4-nitrophenolate |
| SMILES | CC1(C)CC(=O)C2C(=NC3=C(C(=O)c4ccccc43)[C@H]2c2cc([N+](=O)[O-])ccc2[O-])C1 |
| InChI | InChI=1S/C24H20N2O5/c1-24(2)10-16-20(18(28)11-24)19(15-9-12(26(30)31)7-8-17(15)27)21-22(25-16)13-5-3-4-6-14(13)23(21)29/h3-9,19-20,27H,10-11H2,1-2H3/p-1/t19-,20?/m0/s1 |
| InChIKey | LGDKESKBEHWEDB-XJDOXCRVSA-M |
| XLogP | 3.82 |
| TPSA | 112.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|