C19H20N2O2S — CID 2324815
(6S)-9,9-dimethyl-6-phenyl-3,6,8,10-tetrahydro-2H-[1,3]thiazino[2,3-b]quinazoline-4,7-dione (PubChem CID 2324815) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is (6S)-9,9-dimethyl-6-phenyl-3,6,8,10-tetrahydro-2H-[1,3]thiazino[2,3-b]quinazoline-4,7-dione.
| Compound Name | (6S)-9,9-dimethyl-6-phenyl-3,6,8,10-tetrahydro-2H-[1,3]thiazino[2,3-b]quinazoline-4,7-dione |
|---|---|
| PubChem CID | 2324815 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (6S)-9,9-dimethyl-6-phenyl-3,6,8,10-tetrahydro-2H-[1,3]thiazino[2,3-b]quinazoline-4,7-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N=C1SCCC(=O)N1[C@H]2c1ccccc1 |
| InChI | InChI=1S/C19H20N2O2S/c1-19(2)10-13-16(14(22)11-19)17(12-6-4-3-5-7-12)21-15(23)8-9-24-18(21)20-13/h3-7,17H,8-11H2,1-2H3/t17-/m0/s1 |
| InChIKey | XEJRTMXEFCEHRW-KRWDZBQOSA-N |
| XLogP | 3.71 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |