C20H22N2O3S — CID 3576556
6-(4-methoxyphenyl)-9,9-dimethyl-3,6,8,10-tetrahydro-2H-[1,3]thiazino[2,3-b]quinazoline-4,7-dione (PubChem CID 3576556) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-9,9-dimethyl-3,6,8,10-tetrahydro-2H-[1,3]thiazino[2,3-b]quinazoline-4,7-dione.
| Compound Name | 6-(4-methoxyphenyl)-9,9-dimethyl-3,6,8,10-tetrahydro-2H-[1,3]thiazino[2,3-b]quinazoline-4,7-dione |
|---|---|
| PubChem CID | 3576556 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 6-(4-methoxyphenyl)-9,9-dimethyl-3,6,8,10-tetrahydro-2H-[1,3]thiazino[2,3-b]quinazoline-4,7-dione |
| SMILES | COc1ccc(C2C3=C(CC(C)(C)CC3=O)N=C3SCCC(=O)N32)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-20(2)10-14-17(15(23)11-20)18(12-4-6-13(25-3)7-5-12)22-16(24)8-9-26-19(22)21-14/h4-7,18H,8-11H2,1-3H3 |
| InChIKey | LQSATMTZKLMQQT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |