C21H24N2O4S — CID 2328145
(6R)-6-(3,4-dimethoxyphenyl)-9,9-dimethyl-3,6,8,10-tetrahydro-2H-[1,3]thiazino[2,3-b]quinazoline-4,7-dione (PubChem CID 2328145) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is (6R)-6-(3,4-dimethoxyphenyl)-9,9-dimethyl-3,6,8,10-tetrahydro-2H-[1,3]thiazino[2,3-b]quinazoline-4,7-dione.
| Compound Name | (6R)-6-(3,4-dimethoxyphenyl)-9,9-dimethyl-3,6,8,10-tetrahydro-2H-[1,3]thiazino[2,3-b]quinazoline-4,7-dione |
|---|---|
| PubChem CID | 2328145 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (6R)-6-(3,4-dimethoxyphenyl)-9,9-dimethyl-3,6,8,10-tetrahydro-2H-[1,3]thiazino[2,3-b]quinazoline-4,7-dione |
| SMILES | COc1ccc([C@@H]2C3=C(CC(C)(C)CC3=O)N=C3SCCC(=O)N32)cc1OC |
| InChI | InChI=1S/C21H24N2O4S/c1-21(2)10-13-18(14(24)11-21)19(23-17(25)7-8-28-20(23)22-13)12-5-6-15(26-3)16(9-12)27-4/h5-6,9,19H,7-8,10-11H2,1-4H3/t19-/m1/s1 |
| InChIKey | WCRXHTVYBYBHAZ-LJQANCHMSA-N |
| XLogP | 3.72 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |