C22H26N2O5S — CID 2324811
(6S)-9,9-dimethyl-6-(3,4,5-trimethoxyphenyl)-3,6,8,10-tetrahydro-2H-[1,3]thiazino[2,3-b]quinazoline-4,7-dione (PubChem CID 2324811) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is (6S)-9,9-dimethyl-6-(3,4,5-trimethoxyphenyl)-3,6,8,10-tetrahydro-2H-[1,3]thiazino[2,3-b]quinazoline-4,7-dione.
| Compound Name | (6S)-9,9-dimethyl-6-(3,4,5-trimethoxyphenyl)-3,6,8,10-tetrahydro-2H-[1,3]thiazino[2,3-b]quinazoline-4,7-dione |
|---|---|
| PubChem CID | 2324811 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | (6S)-9,9-dimethyl-6-(3,4,5-trimethoxyphenyl)-3,6,8,10-tetrahydro-2H-[1,3]thiazino[2,3-b]quinazoline-4,7-dione |
| SMILES | COc1cc([C@H]2C3=C(CC(C)(C)CC3=O)N=C3SCCC(=O)N32)cc(OC)c1OC |
| InChI | InChI=1S/C22H26N2O5S/c1-22(2)10-13-18(14(25)11-22)19(24-17(26)6-7-30-21(24)23-13)12-8-15(27-3)20(29-5)16(9-12)28-4/h8-9,19H,6-7,10-11H2,1-5H3/t19-/m0/s1 |
| InChIKey | HTDUZZJFVNWKMH-IBGZPJMESA-N |
| XLogP | 3.73 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |