C13H11F17O2S — CID 123856276
11-ethylsulfonyl-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoroundecane (PubChem CID 123856276) has the molecular formula C13H11F17O2S and a molecular weight of 554.26 g/mol. Its IUPAC name is 11-ethylsulfonyl-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoroundecane.
| Compound Name | 11-ethylsulfonyl-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoroundecane |
|---|---|
| PubChem CID | 123856276 |
| Molecular Formula | C13H11F17O2S |
| Molecular Weight | 554.26 g/mol |
| Exact Mass | 554.02 |
| IUPAC Name | 11-ethylsulfonyl-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoroundecane |
| SMILES | CCS(=O)(=O)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H11F17O2S/c1-2-33(31,32)5-3-4-6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h2-5H2,1H3 |
| InChIKey | YUVHNJBUDRQNEU-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.26 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|