C14H25F5OS — CID 19799167
1-(4,4,5,5,5-pentafluoropentylsulfinyl)nonane (PubChem CID 19799167) has the molecular formula C14H25F5OS and a molecular weight of 336.41 g/mol. Its IUPAC name is 1-(4,4,5,5,5-pentafluoropentylsulfinyl)nonane.
| Compound Name | 1-(4,4,5,5,5-pentafluoropentylsulfinyl)nonane |
|---|---|
| PubChem CID | 19799167 |
| Molecular Formula | C14H25F5OS |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-(4,4,5,5,5-pentafluoropentylsulfinyl)nonane |
| SMILES | CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H25F5OS/c1-2-3-4-5-6-7-8-11-21(20)12-9-10-13(15,16)14(17,18)19/h2-12H2,1H3 |
| InChIKey | CAICZZJHNJHHDJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|