C18H30N2O4 — CID 123857132
(4S)-4-[[(2R)-2-cyclohexyl-2-formamidoacetyl]-methylamino]-2,5-dimethylhex-2-enoic acid (PubChem CID 123857132) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is (4S)-4-[[(2R)-2-cyclohexyl-2-formamidoacetyl]-methylamino]-2,5-dimethylhex-2-enoic acid.
| Compound Name | (4S)-4-[[(2R)-2-cyclohexyl-2-formamidoacetyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 123857132 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (4S)-4-[[(2R)-2-cyclohexyl-2-formamidoacetyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
| SMILES | CC(=C[C@H](C(C)C)N(C)C(=O)[C@H](NC=O)C1CCCCC1)C(=O)O |
| InChI | InChI=1S/C18H30N2O4/c1-12(2)15(10-13(3)18(23)24)20(4)17(22)16(19-11-21)14-8-6-5-7-9-14/h10-12,14-16H,5-9H2,1-4H3,(H,19,21)(H,23,24)/t15-,16-/m1/s1 |
| InChIKey | ZCNMAVFYMQKQEM-HZPDHXFCSA-N |
| XLogP | 2.20 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|