About hex-3-en-2-ylhydrazine
hex-3-en-2-ylhydrazine (PubChem CID 123857152) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is hex-3-en-2-ylhydrazine.
Molecular Properties
| Compound Name | hex-3-en-2-ylhydrazine |
| PubChem CID | 123857152 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | hex-3-en-2-ylhydrazine |
| SMILES | CCC=CC(C)NN |
| InChI | InChI=1S/C6H14N2/c1-3-4-5-6(2)8-7/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | WEVNQKIMDKCWCZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hex-3-en-2-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-3-en-2-ylhydrazine?
The IUPAC name of hex-3-en-2-ylhydrazine (CID 123857152) is hex-3-en-2-ylhydrazine.
What is the SMILES notation for hex-3-en-2-ylhydrazine?
The canonical SMILES for hex-3-en-2-ylhydrazine is CCC=CC(C)NN.
What is the InChIKey of hex-3-en-2-ylhydrazine?
The InChIKey is WEVNQKIMDKCWCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2/c1-3-4-5-6(2)8-7/h4-6,8H,3,7H2,1-2H3.
What are the key properties of hex-3-en-2-ylhydrazine?
hex-3-en-2-ylhydrazine has a molecular weight of 114.19 g/mol, XLogP of 0.80, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hex-3-en-2-ylhydrazine is sourced from PubChem (CID 123857152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).