C47H38ClN3O5S2 — CID 123857608
benzhydryl (7S)-7-[(3E)-3-(5-chloro-2-methyl-1,3-thiazol-4-yl)-2-oxo-3-trityloxyiminopropyl]-8-oxo-3-sulfanyl-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 123857608) has the molecular formula C47H38ClN3O5S2 and a molecular weight of 824.42 g/mol. Its IUPAC name is benzhydryl (7S)-7-[(3E)-3-(5-chloro-2-methyl-1,3-thiazol-4-yl)-2-oxo-3-trityloxyiminopropyl]-8-oxo-3-sulfanyl-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (7S)-7-[(3E)-3-(5-chloro-2-methyl-1,3-thiazol-4-yl)-2-oxo-3-trityloxyiminopropyl]-8-oxo-3-sulfanyl-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 123857608 |
| Molecular Formula | C47H38ClN3O5S2 |
| Molecular Weight | 824.42 g/mol |
| Exact Mass | 823.19 |
| IUPAC Name | benzhydryl (7S)-7-[(3E)-3-(5-chloro-2-methyl-1,3-thiazol-4-yl)-2-oxo-3-trityloxyiminopropyl]-8-oxo-3-sulfanyl-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | Cc1nc(/C(=N\OC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)C[C@@H]2C(=O)N3C(C(=O)OC(c4ccccc4)c4ccccc4)=C(S)CCC23)c(Cl)s1 |
| InChI | InChI=1S/C47H38ClN3O5S2/c1-30-49-41(44(48)58-30)40(50-56-47(33-21-11-4-12-22-33,34-23-13-5-14-24-34)35-25-15-6-16-26-35)38(52)29-36-37-27-28-39(57)42(51(37)45(36)53)46(54)55-43(31-17-7-2-8-18-31)32-19-9-3-10-20-32/h2-26,36-37,43,57H,27-29H2,1H3/b50-40-/t36-,37?/m0/s1 |
| InChIKey | BLIBDVSDBKQKEB-UCAQHUDUSA-N |
| XLogP | 9.87 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.42 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|