C28H24F3N5O8S2 — CID 123990012
benzhydryl (6R,7S)-7-[(3E)-3-(5-amino-1,2,4-thiadiazol-3-yl)-3-methoxyimino-2-oxopropyl]-8-oxo-3-(trifluoromethylsulfonyloxy)-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 123990012) has the molecular formula C28H24F3N5O8S2 and a molecular weight of 679.66 g/mol. Its IUPAC name is benzhydryl (6R,7S)-7-[(3E)-3-(5-amino-1,2,4-thiadiazol-3-yl)-3-methoxyimino-2-oxopropyl]-8-oxo-3-(trifluoromethylsulfonyloxy)-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R,7S)-7-[(3E)-3-(5-amino-1,2,4-thiadiazol-3-yl)-3-methoxyimino-2-oxopropyl]-8-oxo-3-(trifluoromethylsulfonyloxy)-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 123990012 |
| Molecular Formula | C28H24F3N5O8S2 |
| Molecular Weight | 679.66 g/mol |
| Exact Mass | 679.10 |
| IUPAC Name | benzhydryl (6R,7S)-7-[(3E)-3-(5-amino-1,2,4-thiadiazol-3-yl)-3-methoxyimino-2-oxopropyl]-8-oxo-3-(trifluoromethylsulfonyloxy)-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CO/N=C(/C(=O)C[C@@H]1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(OS(=O)(=O)C(F)(F)F)CC[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C28H24F3N5O8S2/c1-42-34-21(24-33-27(32)45-35-24)19(37)14-17-18-12-13-20(44-46(40,41)28(29,30)31)22(36(18)25(17)38)26(39)43-23(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,17-18,23H,12-14H2,1H3,(H2,32,33,35)/b34-21-/t17-,18+/m0/s1 |
| InChIKey | HFFGQKCSSSSFOD-DBWRNRAHSA-N |
| XLogP | 3.46 |
| TPSA | 180.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.66 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|