C21H18F4OSi — CID 123857740
[4-[4-[(3,5-difluoro-4-methylphenoxy)-difluoromethyl]phenyl]phenyl]methylsilane (PubChem CID 123857740) has the molecular formula C21H18F4OSi and a molecular weight of 390.45 g/mol. Its IUPAC name is [4-[4-[(3,5-difluoro-4-methylphenoxy)-difluoromethyl]phenyl]phenyl]methylsilane.
| Compound Name | [4-[4-[(3,5-difluoro-4-methylphenoxy)-difluoromethyl]phenyl]phenyl]methylsilane |
|---|---|
| PubChem CID | 123857740 |
| Molecular Formula | C21H18F4OSi |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | [4-[4-[(3,5-difluoro-4-methylphenoxy)-difluoromethyl]phenyl]phenyl]methylsilane |
| SMILES | Cc1c(F)cc(OC(F)(F)c2ccc(-c3ccc(C[SiH3])cc3)cc2)cc1F |
| InChI | InChI=1S/C21H18F4OSi/c1-13-19(22)10-18(11-20(13)23)26-21(24,25)17-8-6-16(7-9-17)15-4-2-14(12-27)3-5-15/h2-11H,12H2,1,27H3 |
| InChIKey | YFGDZIKYVZBNCX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|