C15H16F2OSi — CID 123161853
[4-[difluoro-(4-methylphenoxy)methyl]phenyl]methylsilane (PubChem CID 123161853) has the molecular formula C15H16F2OSi and a molecular weight of 278.37 g/mol. Its IUPAC name is [4-[difluoro-(4-methylphenoxy)methyl]phenyl]methylsilane.
| Compound Name | [4-[difluoro-(4-methylphenoxy)methyl]phenyl]methylsilane |
|---|---|
| PubChem CID | 123161853 |
| Molecular Formula | C15H16F2OSi |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | [4-[difluoro-(4-methylphenoxy)methyl]phenyl]methylsilane |
| SMILES | Cc1ccc(OC(F)(F)c2ccc(C[SiH3])cc2)cc1 |
| InChI | InChI=1S/C15H16F2OSi/c1-11-2-8-14(9-3-11)18-15(16,17)13-6-4-12(10-19)5-7-13/h2-9H,10H2,1,19H3 |
| InChIKey | ITHLTZMZGXNPEA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|