C29H27F3O — CID 145331542
1-[4-[difluoro-(4-methylphenoxy)methyl]phenyl]-2-fluoro-4-(4-methylphenyl)benzene;ethane (PubChem CID 145331542) has the molecular formula C29H27F3O and a molecular weight of 448.53 g/mol. Its IUPAC name is 1-[4-[difluoro-(4-methylphenoxy)methyl]phenyl]-2-fluoro-4-(4-methylphenyl)benzene;ethane.
| Compound Name | 1-[4-[difluoro-(4-methylphenoxy)methyl]phenyl]-2-fluoro-4-(4-methylphenyl)benzene;ethane |
|---|---|
| PubChem CID | 145331542 |
| Molecular Formula | C29H27F3O |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 1-[4-[difluoro-(4-methylphenoxy)methyl]phenyl]-2-fluoro-4-(4-methylphenyl)benzene;ethane |
| SMILES | CC.Cc1ccc(OC(F)(F)c2ccc(-c3ccc(-c4ccc(C)cc4)cc3F)cc2)cc1 |
| InChI | InChI=1S/C27H21F3O.C2H6/c1-18-3-7-20(8-4-18)22-11-16-25(26(28)17-22)21-9-12-23(13-10-21)27(29,30)31-24-14-5-19(2)6-15-24;1-2/h3-17H,1-2H3;1-2H3 |
| InChIKey | MBVJNMLMQBKAFJ-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |