C19H25F3O2 — CID 123154115
1-[difluoro-[4-(fluoromethoxy)phenoxy]methyl]-4-methylbenzene;ethane (PubChem CID 123154115) has the molecular formula C19H25F3O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[difluoro-[4-(fluoromethoxy)phenoxy]methyl]-4-methylbenzene;ethane.
| Compound Name | 1-[difluoro-[4-(fluoromethoxy)phenoxy]methyl]-4-methylbenzene;ethane |
|---|---|
| PubChem CID | 123154115 |
| Molecular Formula | C19H25F3O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-[difluoro-[4-(fluoromethoxy)phenoxy]methyl]-4-methylbenzene;ethane |
| SMILES | CC.CC.Cc1ccc(C(F)(F)Oc2ccc(OCF)cc2)cc1 |
| InChI | InChI=1S/C15H13F3O2.2C2H6/c1-11-2-4-12(5-3-11)15(17,18)20-14-8-6-13(7-9-14)19-10-16;2*1-2/h2-9H,10H2,1H3;2*1-2H3 |
| InChIKey | ZDUMHAPBKIZNBC-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |