C16H16ClF3N4O2S2 — CID 123857785
1-[(4-chloro-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-prop-2-ynylamino]-3-(3,3,3-trifluoropropylsulfinyl)propan-1-ol (PubChem CID 123857785) has the molecular formula C16H16ClF3N4O2S2 and a molecular weight of 452.91 g/mol. Its IUPAC name is 1-[(4-chloro-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-prop-2-ynylamino]-3-(3,3,3-trifluoropropylsulfinyl)propan-1-ol.
| Compound Name | 1-[(4-chloro-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-prop-2-ynylamino]-3-(3,3,3-trifluoropropylsulfinyl)propan-1-ol |
|---|---|
| PubChem CID | 123857785 |
| Molecular Formula | C16H16ClF3N4O2S2 |
| Molecular Weight | 452.91 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 1-[(4-chloro-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-prop-2-ynylamino]-3-(3,3,3-trifluoropropylsulfinyl)propan-1-ol |
| SMILES | C#CCN(c1sc(-c2cncnc2)nc1Cl)C(O)CCS(=O)CCC(F)(F)F |
| InChI | InChI=1S/C16H16ClF3N4O2S2/c1-2-5-24(12(25)3-6-28(26)7-4-16(18,19)20)15-13(17)23-14(27-15)11-8-21-10-22-9-11/h1,8-10,12,25H,3-7H2 |
| InChIKey | MVWHBWJDWDIGKM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.91 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|