C18H18ClF3N4OS2 — CID 139334105
N-(4-chloro-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-N-pent-2-ynyl-3-(3,3,3-trifluoropropylsulfanyl)propanamide (PubChem CID 139334105) has the molecular formula C18H18ClF3N4OS2 and a molecular weight of 462.95 g/mol. Its IUPAC name is N-(4-chloro-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-N-pent-2-ynyl-3-(3,3,3-trifluoropropylsulfanyl)propanamide.
| Compound Name | N-(4-chloro-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-N-pent-2-ynyl-3-(3,3,3-trifluoropropylsulfanyl)propanamide |
|---|---|
| PubChem CID | 139334105 |
| Molecular Formula | C18H18ClF3N4OS2 |
| Molecular Weight | 462.95 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | N-(4-chloro-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-N-pent-2-ynyl-3-(3,3,3-trifluoropropylsulfanyl)propanamide |
| SMILES | CCC#CCN(C(=O)CCSCCC(F)(F)F)c1sc(-c2cncnc2)nc1Cl |
| InChI | InChI=1S/C18H18ClF3N4OS2/c1-2-3-4-7-26(14(27)5-8-28-9-6-18(20,21)22)17-15(19)25-16(29-17)13-10-23-12-24-11-13/h10-12H,2,5-9H2,1H3 |
| InChIKey | XPPHJZFXBSCTQW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.95 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|