C18H18F2N4OS2 — CID 118029832
3-[(2,2-difluorocyclopropyl)methylsulfanyl]-N-(4-methyl-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-N-prop-2-ynylpropanamide (PubChem CID 118029832) has the molecular formula C18H18F2N4OS2 and a molecular weight of 408.50 g/mol. Its IUPAC name is 3-[(2,2-difluorocyclopropyl)methylsulfanyl]-N-(4-methyl-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-N-prop-2-ynylpropanamide.
| Compound Name | 3-[(2,2-difluorocyclopropyl)methylsulfanyl]-N-(4-methyl-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 118029832 |
| Molecular Formula | C18H18F2N4OS2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 3-[(2,2-difluorocyclopropyl)methylsulfanyl]-N-(4-methyl-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-N-prop-2-ynylpropanamide |
| SMILES | C#CCN(C(=O)CCSCC1CC1(F)F)c1sc(-c2cncnc2)nc1C |
| InChI | InChI=1S/C18H18F2N4OS2/c1-3-5-24(15(25)4-6-26-10-14-7-18(14,19)20)17-12(2)23-16(27-17)13-8-21-11-22-9-13/h1,8-9,11,14H,4-7,10H2,2H3 |
| InChIKey | GXRDKUXZXAHICH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|