C25H23ClF3N3O4 — CID 123857891
3-[5-[6-amino-5-[1-[5-chloro-2-(trifluoromethyl)phenyl]ethoxy]-3-pyridinyl]-2-pyridinyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol (PubChem CID 123857891) has the molecular formula C25H23ClF3N3O4 and a molecular weight of 521.92 g/mol. Its IUPAC name is 3-[5-[6-amino-5-[1-[5-chloro-2-(trifluoromethyl)phenyl]ethoxy]-3-pyridinyl]-2-pyridinyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol.
| Compound Name | 3-[5-[6-amino-5-[1-[5-chloro-2-(trifluoromethyl)phenyl]ethoxy]-3-pyridinyl]-2-pyridinyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 123857891 |
| Molecular Formula | C25H23ClF3N3O4 |
| Molecular Weight | 521.92 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 3-[5-[6-amino-5-[1-[5-chloro-2-(trifluoromethyl)phenyl]ethoxy]-3-pyridinyl]-2-pyridinyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
| SMILES | CC(Oc1cc(-c2ccc(C3COC4C(O)COC34)nc2)cnc1N)c1cc(Cl)ccc1C(F)(F)F |
| InChI | InChI=1S/C25H23ClF3N3O4/c1-12(16-7-15(26)3-4-18(16)25(27,28)29)36-21-6-14(9-32-24(21)30)13-2-5-19(31-8-13)17-10-34-23-20(33)11-35-22(17)23/h2-9,12,17,20,22-23,33H,10-11H2,1H3,(H2,30,32) |
| InChIKey | LIWCIZRXXBVNEQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.92 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |