C32H37F3N2O8 — CID 123859121
4-butyl-6-(2,2-difluoropropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione;4-(3-cyclopropylpropyl)-6-(2-fluoropropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 123859121) has the molecular formula C32H37F3N2O8 and a molecular weight of 634.65 g/mol. Its IUPAC name is 4-butyl-6-(2,2-difluoropropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione;4-(3-cyclopropylpropyl)-6-(2-fluoropropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-butyl-6-(2,2-difluoropropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione;4-(3-cyclopropylpropyl)-6-(2-fluoropropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 123859121 |
| Molecular Formula | C32H37F3N2O8 |
| Molecular Weight | 634.65 g/mol |
| Exact Mass | 634.25 |
| IUPAC Name | 4-butyl-6-(2,2-difluoropropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione;4-(3-cyclopropylpropyl)-6-(2-fluoropropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | CC(F)CN1C(=O)Cc2oc(=O)cc(CCCC3CC3)c2C1=O.CCCCc1cc(=O)oc2c1C(=O)N(CC(C)(F)F)C(=O)C2 |
| InChI | InChI=1S/C17H20FNO4.C15H17F2NO4/c1-10(18)9-19-14(20)8-13-16(17(19)22)12(7-15(21)23-13)4-2-3-11-5-6-11;1-3-4-5-9-6-12(20)22-10-7-11(19)18(8-15(2,16)17)14(21)13(9)10/h7,10-11H,2-6,8-9H2,1H3;6H,3-5,7-8H2,1-2H3 |
| InChIKey | FIFATAJBRSTODY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 135.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.65 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|