C20H30N+ — CID 123859665
4-ethyl-3,7-dimethyl-6-methylidene-1-prop-1-enyl-5-prop-2-enylidene-4-propylazepin-1-ium (PubChem CID 123859665) has the molecular formula C20H30N+ and a molecular weight of 284.47 g/mol. Its IUPAC name is 4-ethyl-3,7-dimethyl-6-methylidene-1-prop-1-enyl-5-prop-2-enylidene-4-propylazepin-1-ium.
| Compound Name | 4-ethyl-3,7-dimethyl-6-methylidene-1-prop-1-enyl-5-prop-2-enylidene-4-propylazepin-1-ium |
|---|---|
| PubChem CID | 123859665 |
| Molecular Formula | C20H30N+ |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 4-ethyl-3,7-dimethyl-6-methylidene-1-prop-1-enyl-5-prop-2-enylidene-4-propylazepin-1-ium |
| SMILES | C=CC=C1C(=C)C(C)=[N+](C=CC)C=C(C)C1(CC)CCC |
| InChI | InChI=1S/C20H30N/c1-8-12-19-17(6)18(7)21(14-10-3)15-16(5)20(19,11-4)13-9-2/h8,10,12,14-15H,1,6,9,11,13H2,2-5,7H3/q+1 |
| InChIKey | OUYBYKQHNWZSMK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|